C10H11F2NO — CID 82341709
4-amino-1-(3,4-difluorophenyl)butan-1-one (PubChem CID 82341709) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 4-amino-1-(3,4-difluorophenyl)butan-1-one.
| Compound Name | 4-amino-1-(3,4-difluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 82341709 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 4-amino-1-(3,4-difluorophenyl)butan-1-one |
| SMILES | NCCCC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H11F2NO/c11-8-4-3-7(6-9(8)12)10(14)2-1-5-13/h3-4,6H,1-2,5,13H2 |
| InChIKey | BFQHPUWEAOEBSJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |