C14H15F2NO4 — CID 119352843
4-[[4-(3,4-difluorophenyl)-4-oxobutanoyl]amino]butanoic acid (PubChem CID 119352843) has the molecular formula C14H15F2NO4 and a molecular weight of 299.27 g/mol. Its IUPAC name is 4-[[4-(3,4-difluorophenyl)-4-oxobutanoyl]amino]butanoic acid.
| Compound Name | 4-[[4-(3,4-difluorophenyl)-4-oxobutanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119352843 |
| Molecular Formula | C14H15F2NO4 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-[[4-(3,4-difluorophenyl)-4-oxobutanoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)CCC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H15F2NO4/c15-10-4-3-9(8-11(10)16)12(18)5-6-13(19)17-7-1-2-14(20)21/h3-4,8H,1-2,5-7H2,(H,17,19)(H,20,21) |
| InChIKey | SKJCGVXICZKACZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|