C12H12O — CID 114962056
1-(3,4-dimethylphenyl)but-3-yn-1-one (PubChem CID 114962056) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)but-3-yn-1-one.
| Compound Name | 1-(3,4-dimethylphenyl)but-3-yn-1-one |
|---|---|
| PubChem CID | 114962056 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 1-(3,4-dimethylphenyl)but-3-yn-1-one |
| SMILES | C#CCC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H12O/c1-4-5-12(13)11-7-6-9(2)10(3)8-11/h1,6-8H,5H2,2-3H3 |
| InChIKey | ZYEJNCRCYGQHGZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|