C20H22O2Se — CID 135086680
1-(3,4-dimethylphenyl)-2-[2-(3,4-dimethylphenyl)-2-oxoethyl]selanylethanone (PubChem CID 135086680) has the molecular formula C20H22O2Se and a molecular weight of 373.35 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[2-(3,4-dimethylphenyl)-2-oxoethyl]selanylethanone.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[2-(3,4-dimethylphenyl)-2-oxoethyl]selanylethanone |
|---|---|
| PubChem CID | 135086680 |
| Molecular Formula | C20H22O2Se |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[2-(3,4-dimethylphenyl)-2-oxoethyl]selanylethanone |
| SMILES | Cc1ccc(C(=O)C[Se]CC(=O)c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C20H22O2Se/c1-13-5-7-17(9-15(13)3)19(21)11-23-12-20(22)18-8-6-14(2)16(4)10-18/h5-10H,11-12H2,1-4H3 |
| InChIKey | SPDDJDWKTXCXCE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|