C13H18O2 — CID 105093547
1-(3,4-dimethylphenyl)-3-ethoxypropan-1-one (PubChem CID 105093547) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-ethoxypropan-1-one.
| Compound Name | 1-(3,4-dimethylphenyl)-3-ethoxypropan-1-one |
|---|---|
| PubChem CID | 105093547 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-ethoxypropan-1-one |
| SMILES | CCOCCC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H18O2/c1-4-15-8-7-13(14)12-6-5-10(2)11(3)9-12/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | JOPKANIWYOQHAV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|