C14H17NO — CID 103708908
3,4-dimethyl-N-pent-4-ynylbenzamide (PubChem CID 103708908) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 3,4-dimethyl-N-pent-4-ynylbenzamide.
| Compound Name | 3,4-dimethyl-N-pent-4-ynylbenzamide |
|---|---|
| PubChem CID | 103708908 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3,4-dimethyl-N-pent-4-ynylbenzamide |
| SMILES | C#CCCCNC(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H17NO/c1-4-5-6-9-15-14(16)13-8-7-11(2)12(3)10-13/h1,7-8,10H,5-6,9H2,2-3H3,(H,15,16) |
| InChIKey | BZMSKJLPLLIIOI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|