C13H14BrNO — CID 103855215
4-bromo-3-methyl-N-pent-4-ynylbenzamide (PubChem CID 103855215) has the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. Its IUPAC name is 4-bromo-3-methyl-N-pent-4-ynylbenzamide.
| Compound Name | 4-bromo-3-methyl-N-pent-4-ynylbenzamide |
|---|---|
| PubChem CID | 103855215 |
| Molecular Formula | C13H14BrNO |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 4-bromo-3-methyl-N-pent-4-ynylbenzamide |
| SMILES | C#CCCCNC(=O)c1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C13H14BrNO/c1-3-4-5-8-15-13(16)11-6-7-12(14)10(2)9-11/h1,6-7,9H,4-5,8H2,2H3,(H,15,16) |
| InChIKey | MNZWGZOJERGTDI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|