C15H17FN2O3 — CID 9387313
[(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 3-fluoro-4-methylbenzoate (PubChem CID 9387313) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 3-fluoro-4-methylbenzoate.
| Compound Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 3-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 9387313 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 3-fluoro-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C)C(=O)N(C)CCC#N)cc1F |
| InChI | InChI=1S/C15H17FN2O3/c1-10-5-6-12(9-13(10)16)15(20)21-11(2)14(19)18(3)8-4-7-17/h5-6,9,11H,4,8H2,1-3H3/t11-/m0/s1 |
| InChIKey | HROHHBXTCWYLFU-NSHDSACASA-N |
| XLogP | 2.05 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |