C15H17ClN2O5S — CID 8575596
[(2R)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 8575596) has the molecular formula C15H17ClN2O5S and a molecular weight of 372.83 g/mol. Its IUPAC name is [(2R)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [(2R)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 8575596 |
| Molecular Formula | C15H17ClN2O5S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | [(2R)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | C[C@@H](OC(=O)c1cc(S(C)(=O)=O)ccc1Cl)C(=O)N(C)CCC#N |
| InChI | InChI=1S/C15H17ClN2O5S/c1-10(14(19)18(2)8-4-7-17)23-15(20)12-9-11(24(3,21)22)5-6-13(12)16/h5-6,9-10H,4,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | DBYPIJDIJVRIHY-SNVBAGLBSA-N |
| XLogP | 1.66 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |