C17H16ClN3O3 — CID 8739199
[(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloroquinoline-4-carboxylate (PubChem CID 8739199) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloroquinoline-4-carboxylate.
| Compound Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloroquinoline-4-carboxylate |
|---|---|
| PubChem CID | 8739199 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-chloroquinoline-4-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc(Cl)nc2ccccc12)C(=O)N(C)CCC#N |
| InChI | InChI=1S/C17H16ClN3O3/c1-11(16(22)21(2)9-5-8-19)24-17(23)13-10-15(18)20-14-7-4-3-6-12(13)14/h3-4,6-7,10-11H,5,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | NBDZWTULPMVBET-NSHDSACASA-N |
| XLogP | 2.81 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|