C15H16BrClN2O4 — CID 8957650
[(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-(4-bromo-2-chlorophenoxy)acetate (PubChem CID 8957650) has the molecular formula C15H16BrClN2O4 and a molecular weight of 403.66 g/mol. Its IUPAC name is [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-(4-bromo-2-chlorophenoxy)acetate.
| Compound Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-(4-bromo-2-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 8957650 |
| Molecular Formula | C15H16BrClN2O4 |
| Molecular Weight | 403.66 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 2-(4-bromo-2-chlorophenoxy)acetate |
| SMILES | C[C@H](OC(=O)COc1ccc(Br)cc1Cl)C(=O)N(C)CCC#N |
| InChI | InChI=1S/C15H16BrClN2O4/c1-10(15(21)19(2)7-3-6-18)23-14(20)9-22-13-5-4-11(16)8-12(13)17/h4-5,8,10H,3,7,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | WELIDAQHXBPGEQ-JTQLQIEISA-N |
| XLogP | 2.79 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.66 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |