C15H16N6O3 — CID 8953299
[(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate (PubChem CID 8953299) has the molecular formula C15H16N6O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 8953299 |
| Molecular Formula | C15H16N6O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [(2S)-1-[2-cyanoethyl(methyl)amino]-1-oxopropan-2-yl] 4-(tetrazol-1-yl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(-n2cnnn2)cc1)C(=O)N(C)CCC#N |
| InChI | InChI=1S/C15H16N6O3/c1-11(14(22)20(2)9-3-8-16)24-15(23)12-4-6-13(7-5-12)21-10-17-18-19-21/h4-7,10-11H,3,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | KRQWEHAJFVCFKX-NSHDSACASA-N |
| XLogP | 0.58 |
| TPSA | 114.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |