C12H15F3N2O — CID 65101704
N-(3-aminopropyl)-N-ethyl-2,4,6-trifluorobenzamide (PubChem CID 65101704) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-ethyl-2,4,6-trifluorobenzamide.
| Compound Name | N-(3-aminopropyl)-N-ethyl-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 65101704 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-(3-aminopropyl)-N-ethyl-2,4,6-trifluorobenzamide |
| SMILES | CCN(CCCN)C(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O/c1-2-17(5-3-4-16)12(18)11-9(14)6-8(13)7-10(11)15/h6-7H,2-5,16H2,1H3 |
| InChIKey | HSDPKDLVAUFCGN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |