C10H10FN3O — CID 64949290
N-(2-cyanoethyl)-3-fluoro-N-methylpyridine-4-carboxamide (PubChem CID 64949290) has the molecular formula C10H10FN3O and a molecular weight of 207.21 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-fluoro-N-methylpyridine-4-carboxamide.
| Compound Name | N-(2-cyanoethyl)-3-fluoro-N-methylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 64949290 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-(2-cyanoethyl)-3-fluoro-N-methylpyridine-4-carboxamide |
| SMILES | CN(CCC#N)C(=O)c1ccncc1F |
| InChI | InChI=1S/C10H10FN3O/c1-14(6-2-4-12)10(15)8-3-5-13-7-9(8)11/h3,5,7H,2,6H2,1H3 |
| InChIKey | WAMIBPPUEDIHIQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |