C8H9FN2O — CID 64950687
3-fluoro-N,N-dimethylpyridine-4-carboxamide (PubChem CID 64950687) has the molecular formula C8H9FN2O and a molecular weight of 168.17 g/mol. Its IUPAC name is 3-fluoro-N,N-dimethylpyridine-4-carboxamide.
| Compound Name | 3-fluoro-N,N-dimethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 64950687 |
| Molecular Formula | C8H9FN2O |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 3-fluoro-N,N-dimethylpyridine-4-carboxamide |
| SMILES | CN(C)C(=O)c1ccncc1F |
| InChI | InChI=1S/C8H9FN2O/c1-11(2)8(12)6-3-4-10-5-7(6)9/h3-5H,1-2H3 |
| InChIKey | WFSKYALEBPWQJD-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |