C14H22FN3O — CID 115646478
N-[2-(dimethylamino)ethyl]-3-fluoro-N-(2-methylpropyl)pyridine-4-carboxamide (PubChem CID 115646478) has the molecular formula C14H22FN3O and a molecular weight of 267.35 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-fluoro-N-(2-methylpropyl)pyridine-4-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-fluoro-N-(2-methylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115646478 |
| Molecular Formula | C14H22FN3O |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-fluoro-N-(2-methylpropyl)pyridine-4-carboxamide |
| SMILES | CC(C)CN(CCN(C)C)C(=O)c1ccncc1F |
| InChI | InChI=1S/C14H22FN3O/c1-11(2)10-18(8-7-17(3)4)14(19)12-5-6-16-9-13(12)15/h5-6,9,11H,7-8,10H2,1-4H3 |
| InChIKey | QSGPZSZJAJVKHT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |