C10H11N3O2 — CID 105062562
3-[2-cyanoethyl(methyl)amino]pyridine-4-carboxylic acid (PubChem CID 105062562) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 3-[2-cyanoethyl(methyl)amino]pyridine-4-carboxylic acid.
| Compound Name | 3-[2-cyanoethyl(methyl)amino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 105062562 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-[2-cyanoethyl(methyl)amino]pyridine-4-carboxylic acid |
| SMILES | CN(CCC#N)c1cnccc1C(=O)O |
| InChI | InChI=1S/C10H11N3O2/c1-13(6-2-4-11)9-7-12-5-3-8(9)10(14)15/h3,5,7H,2,6H2,1H3,(H,14,15) |
| InChIKey | ZXHWEVAXIZAUAO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |