C13H13BrF3NO — CID 80672919
N-[(3-bromocyclobutyl)methyl]-2,4,6-trifluoro-N-methylbenzamide (PubChem CID 80672919) has the molecular formula C13H13BrF3NO and a molecular weight of 336.15 g/mol. Its IUPAC name is N-[(3-bromocyclobutyl)methyl]-2,4,6-trifluoro-N-methylbenzamide.
| Compound Name | N-[(3-bromocyclobutyl)methyl]-2,4,6-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 80672919 |
| Molecular Formula | C13H13BrF3NO |
| Molecular Weight | 336.15 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | N-[(3-bromocyclobutyl)methyl]-2,4,6-trifluoro-N-methylbenzamide |
| SMILES | CN(CC1CC(Br)C1)C(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H13BrF3NO/c1-18(6-7-2-8(14)3-7)13(19)12-10(16)4-9(15)5-11(12)17/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | RSNDVFAFQRTHBT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|