C14H18BrNO2 — CID 80672604
N-[(3-bromocyclobutyl)methyl]-2-hydroxy-N,4-dimethylbenzamide (PubChem CID 80672604) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is N-[(3-bromocyclobutyl)methyl]-2-hydroxy-N,4-dimethylbenzamide.
| Compound Name | N-[(3-bromocyclobutyl)methyl]-2-hydroxy-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 80672604 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-[(3-bromocyclobutyl)methyl]-2-hydroxy-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)CC2CC(Br)C2)c(O)c1 |
| InChI | InChI=1S/C14H18BrNO2/c1-9-3-4-12(13(17)5-9)14(18)16(2)8-10-6-11(15)7-10/h3-5,10-11,17H,6-8H2,1-2H3 |
| InChIKey | XEINXHGQVRXJHV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|