C11H15NO2 — CID 43243493
N-ethyl-2-hydroxy-N,4-dimethylbenzamide (PubChem CID 43243493) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is N-ethyl-2-hydroxy-N,4-dimethylbenzamide.
| Compound Name | N-ethyl-2-hydroxy-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 43243493 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | N-ethyl-2-hydroxy-N,4-dimethylbenzamide |
| SMILES | CCN(C)C(=O)c1ccc(C)cc1O |
| InChI | InChI=1S/C11H15NO2/c1-4-12(3)11(14)9-6-5-8(2)7-10(9)13/h5-7,13H,4H2,1-3H3 |
| InChIKey | GCEISWSQHPLZIG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |