C12H17NO — CID 59887663
N-ethyl-N,2,4-trimethylbenzamide (PubChem CID 59887663) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is N-ethyl-N,2,4-trimethylbenzamide.
| Compound Name | N-ethyl-N,2,4-trimethylbenzamide |
|---|---|
| PubChem CID | 59887663 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | N-ethyl-N,2,4-trimethylbenzamide |
| SMILES | CCN(C)C(=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C12H17NO/c1-5-13(4)12(14)11-7-6-9(2)8-10(11)3/h6-8H,5H2,1-4H3 |
| InChIKey | AAHQMGWWMKJWTN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |