C15H18N2O — CID 134005674
N-ethyl-N,2,6-trimethylquinoline-4-carboxamide (PubChem CID 134005674) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-ethyl-N,2,6-trimethylquinoline-4-carboxamide.
| Compound Name | N-ethyl-N,2,6-trimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 134005674 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-ethyl-N,2,6-trimethylquinoline-4-carboxamide |
| SMILES | CCN(C)C(=O)c1cc(C)nc2ccc(C)cc12 |
| InChI | InChI=1S/C15H18N2O/c1-5-17(4)15(18)13-9-11(3)16-14-7-6-10(2)8-12(13)14/h6-9H,5H2,1-4H3 |
| InChIKey | YDHJVMAGIROQRS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |