C19H27N3O — CID 55675834
N-[2-(diethylamino)propyl]-2,6-dimethylquinoline-4-carboxamide (PubChem CID 55675834) has the molecular formula C19H27N3O and a molecular weight of 313.45 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-2,6-dimethylquinoline-4-carboxamide.
| Compound Name | N-[2-(diethylamino)propyl]-2,6-dimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55675834 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-[2-(diethylamino)propyl]-2,6-dimethylquinoline-4-carboxamide |
| SMILES | CCN(CC)C(C)CNC(=O)c1cc(C)nc2ccc(C)cc12 |
| InChI | InChI=1S/C19H27N3O/c1-6-22(7-2)15(5)12-20-19(23)17-11-14(4)21-18-9-8-13(3)10-16(17)18/h8-11,15H,6-7,12H2,1-5H3,(H,20,23) |
| InChIKey | BAHQAXBSKRJKFS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |