C17H18BrNO — CID 60628421
N-[(4-bromophenyl)methyl]-N,2,4-trimethylbenzamide (PubChem CID 60628421) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-N,2,4-trimethylbenzamide.
| Compound Name | N-[(4-bromophenyl)methyl]-N,2,4-trimethylbenzamide |
|---|---|
| PubChem CID | 60628421 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-N,2,4-trimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)Cc2ccc(Br)cc2)c(C)c1 |
| InChI | InChI=1S/C17H18BrNO/c1-12-4-9-16(13(2)10-12)17(20)19(3)11-14-5-7-15(18)8-6-14/h4-10H,11H2,1-3H3 |
| InChIKey | DNXWJLIHLSWCNJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |