C18H20BrNO2 — CID 55833445
4-bromo-N-[(4-ethoxyphenyl)methyl]-N,2-dimethylbenzamide (PubChem CID 55833445) has the molecular formula C18H20BrNO2 and a molecular weight of 362.27 g/mol. Its IUPAC name is 4-bromo-N-[(4-ethoxyphenyl)methyl]-N,2-dimethylbenzamide.
| Compound Name | 4-bromo-N-[(4-ethoxyphenyl)methyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 55833445 |
| Molecular Formula | C18H20BrNO2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-bromo-N-[(4-ethoxyphenyl)methyl]-N,2-dimethylbenzamide |
| SMILES | CCOc1ccc(CN(C)C(=O)c2ccc(Br)cc2C)cc1 |
| InChI | InChI=1S/C18H20BrNO2/c1-4-22-16-8-5-14(6-9-16)12-20(3)18(21)17-10-7-15(19)11-13(17)2/h5-11H,4,12H2,1-3H3 |
| InChIKey | NRKMHFQXUDXKIU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |