C16H19NO3 — CID 134044703
N-[(4-ethoxyphenyl)methyl]-N,3-dimethylfuran-2-carboxamide (PubChem CID 134044703) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)methyl]-N,3-dimethylfuran-2-carboxamide.
| Compound Name | N-[(4-ethoxyphenyl)methyl]-N,3-dimethylfuran-2-carboxamide |
|---|---|
| PubChem CID | 134044703 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N-[(4-ethoxyphenyl)methyl]-N,3-dimethylfuran-2-carboxamide |
| SMILES | CCOc1ccc(CN(C)C(=O)c2occc2C)cc1 |
| InChI | InChI=1S/C16H19NO3/c1-4-19-14-7-5-13(6-8-14)11-17(3)16(18)15-12(2)9-10-20-15/h5-10H,4,11H2,1-3H3 |
| InChIKey | INLDWDUTNOKWBQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |