C16H12Br2N2O — CID 103882406
2,4-dibromo-N-[(4-cyanophenyl)methyl]-N-methylbenzamide (PubChem CID 103882406) has the molecular formula C16H12Br2N2O and a molecular weight of 408.09 g/mol. Its IUPAC name is 2,4-dibromo-N-[(4-cyanophenyl)methyl]-N-methylbenzamide.
| Compound Name | 2,4-dibromo-N-[(4-cyanophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 103882406 |
| Molecular Formula | C16H12Br2N2O |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | 2,4-dibromo-N-[(4-cyanophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccc(C#N)cc1)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H12Br2N2O/c1-20(10-12-4-2-11(9-19)3-5-12)16(21)14-7-6-13(17)8-15(14)18/h2-8H,10H2,1H3 |
| InChIKey | AZRCTWIAMVAVCM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |