C12H13Br2NO — CID 103882559
2,4-dibromo-N-(cyclopropylmethyl)-N-methylbenzamide (PubChem CID 103882559) has the molecular formula C12H13Br2NO and a molecular weight of 347.05 g/mol. Its IUPAC name is 2,4-dibromo-N-(cyclopropylmethyl)-N-methylbenzamide.
| Compound Name | 2,4-dibromo-N-(cyclopropylmethyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 103882559 |
| Molecular Formula | C12H13Br2NO |
| Molecular Weight | 347.05 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | 2,4-dibromo-N-(cyclopropylmethyl)-N-methylbenzamide |
| SMILES | CN(CC1CC1)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H13Br2NO/c1-15(7-8-2-3-8)12(16)10-5-4-9(13)6-11(10)14/h4-6,8H,2-3,7H2,1H3 |
| InChIKey | KGWMZOOLRMGCJR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.05 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |