C14H17Br2NO2 — CID 103883141
2,4-dibromo-N-[2-(cyclopropylmethoxy)ethyl]-N-methylbenzamide (PubChem CID 103883141) has the molecular formula C14H17Br2NO2 and a molecular weight of 391.10 g/mol. Its IUPAC name is 2,4-dibromo-N-[2-(cyclopropylmethoxy)ethyl]-N-methylbenzamide.
| Compound Name | 2,4-dibromo-N-[2-(cyclopropylmethoxy)ethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 103883141 |
| Molecular Formula | C14H17Br2NO2 |
| Molecular Weight | 391.10 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | 2,4-dibromo-N-[2-(cyclopropylmethoxy)ethyl]-N-methylbenzamide |
| SMILES | CN(CCOCC1CC1)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H17Br2NO2/c1-17(6-7-19-9-10-2-3-10)14(18)12-5-4-11(15)8-13(12)16/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | LPHNRAJDXBZAOQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|