C16H19Br2NO — CID 107952430
N-(2-bicyclo[2.2.1]heptanylmethyl)-2,4-dibromo-N-methylbenzamide (PubChem CID 107952430) has the molecular formula C16H19Br2NO and a molecular weight of 401.14 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-2,4-dibromo-N-methylbenzamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-2,4-dibromo-N-methylbenzamide |
|---|---|
| PubChem CID | 107952430 |
| Molecular Formula | C16H19Br2NO |
| Molecular Weight | 401.14 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-2,4-dibromo-N-methylbenzamide |
| SMILES | CN(CC1CC2CCC1C2)C(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H19Br2NO/c1-19(9-12-7-10-2-3-11(12)6-10)16(20)14-5-4-13(17)8-15(14)18/h4-5,8,10-12H,2-3,6-7,9H2,1H3 |
| InChIKey | SYTREUQNKQTNDM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.14 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |