C16H21NO3 — CID 107728501
N-(2-bicyclo[2.2.1]heptanylmethyl)-3,4-dihydroxy-N-methylbenzamide (PubChem CID 107728501) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-3,4-dihydroxy-N-methylbenzamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-3,4-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 107728501 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-3,4-dihydroxy-N-methylbenzamide |
| SMILES | CN(CC1CC2CCC1C2)C(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H21NO3/c1-17(9-13-7-10-2-3-11(13)6-10)16(20)12-4-5-14(18)15(19)8-12/h4-5,8,10-11,13,18-19H,2-3,6-7,9H2,1H3 |
| InChIKey | OFYDISFKMPHDGF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|