C17H22BrNO2 — CID 63682333
N-(2-bicyclo[2.2.1]heptanylmethyl)-3-bromo-4-methoxy-N-methylbenzamide (PubChem CID 63682333) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-3-bromo-4-methoxy-N-methylbenzamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-3-bromo-4-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 63682333 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-3-bromo-4-methoxy-N-methylbenzamide |
| SMILES | COc1ccc(C(=O)N(C)CC2CC3CCC2C3)cc1Br |
| InChI | InChI=1S/C17H22BrNO2/c1-19(10-14-8-11-3-4-12(14)7-11)17(20)13-5-6-16(21-2)15(18)9-13/h5-6,9,11-12,14H,3-4,7-8,10H2,1-2H3 |
| InChIKey | JCFAXHYBKGRQBZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |