C16H23N3O — CID 63686503
N-(2-bicyclo[2.2.1]heptanylmethyl)-N-methyl-6-(methylamino)pyridine-2-carboxamide (PubChem CID 63686503) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-N-methyl-6-(methylamino)pyridine-2-carboxamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-N-methyl-6-(methylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 63686503 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-N-methyl-6-(methylamino)pyridine-2-carboxamide |
| SMILES | CNc1cccc(C(=O)N(C)CC2CC3CCC2C3)n1 |
| InChI | InChI=1S/C16H23N3O/c1-17-15-5-3-4-14(18-15)16(20)19(2)10-13-9-11-6-7-12(13)8-11/h3-5,11-13H,6-10H2,1-2H3,(H,17,18) |
| InChIKey | ZDCCJDLWKHALFA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |