C12H13F2NO — CID 94158144
N-(cyclopropylmethyl)-2,4-difluoro-N-methylbenzamide (PubChem CID 94158144) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,4-difluoro-N-methylbenzamide.
| Compound Name | N-(cyclopropylmethyl)-2,4-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 94158144 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-(cyclopropylmethyl)-2,4-difluoro-N-methylbenzamide |
| SMILES | CN(CC1CC1)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H13F2NO/c1-15(7-8-2-3-8)12(16)10-5-4-9(13)6-11(10)14/h4-6,8H,2-3,7H2,1H3 |
| InChIKey | LXSFEZLFLUYHKR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |