C13H15ClFNO3S — CID 62861010
2-[cyclobutylmethyl(methyl)carbamoyl]-4-fluorobenzenesulfonyl chloride (PubChem CID 62861010) has the molecular formula C13H15ClFNO3S and a molecular weight of 319.79 g/mol. Its IUPAC name is 2-[cyclobutylmethyl(methyl)carbamoyl]-4-fluorobenzenesulfonyl chloride.
| Compound Name | 2-[cyclobutylmethyl(methyl)carbamoyl]-4-fluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 62861010 |
| Molecular Formula | C13H15ClFNO3S |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[cyclobutylmethyl(methyl)carbamoyl]-4-fluorobenzenesulfonyl chloride |
| SMILES | CN(CC1CCC1)C(=O)c1cc(F)ccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C13H15ClFNO3S/c1-16(8-9-3-2-4-9)13(17)11-7-10(15)5-6-12(11)20(14,18)19/h5-7,9H,2-4,8H2,1H3 |
| InChIKey | ZJCGUUGCLGZZHU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |