C13H16F2N2O3S — CID 65389043
N-(cyclobutylmethyl)-2,5-difluoro-N-methyl-3-sulfamoylbenzamide (PubChem CID 65389043) has the molecular formula C13H16F2N2O3S and a molecular weight of 318.35 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-2,5-difluoro-N-methyl-3-sulfamoylbenzamide.
| Compound Name | N-(cyclobutylmethyl)-2,5-difluoro-N-methyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65389043 |
| Molecular Formula | C13H16F2N2O3S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-(cyclobutylmethyl)-2,5-difluoro-N-methyl-3-sulfamoylbenzamide |
| SMILES | CN(CC1CCC1)C(=O)c1cc(F)cc(S(N)(=O)=O)c1F |
| InChI | InChI=1S/C13H16F2N2O3S/c1-17(7-8-3-2-4-8)13(18)10-5-9(14)6-11(12(10)15)21(16,19)20/h5-6,8H,2-4,7H2,1H3,(H2,16,19,20) |
| InChIKey | GJQHOQRIUKPTCT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |