C14H20N2O3S — CID 65387895
N-(cyclobutylmethyl)-N,4-dimethyl-3-sulfamoylbenzamide (PubChem CID 65387895) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-N,4-dimethyl-3-sulfamoylbenzamide.
| Compound Name | N-(cyclobutylmethyl)-N,4-dimethyl-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65387895 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-(cyclobutylmethyl)-N,4-dimethyl-3-sulfamoylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)CC2CCC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C14H20N2O3S/c1-10-6-7-12(8-13(10)20(15,18)19)14(17)16(2)9-11-4-3-5-11/h6-8,11H,3-5,9H2,1-2H3,(H2,15,18,19) |
| InChIKey | ACKMIWZTFVQZSM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |