C13H17FN2O4S — CID 65387046
N-(cyclopropylmethyl)-3-fluoro-4-methoxy-N-methyl-5-sulfamoylbenzamide (PubChem CID 65387046) has the molecular formula C13H17FN2O4S and a molecular weight of 316.35 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-3-fluoro-4-methoxy-N-methyl-5-sulfamoylbenzamide.
| Compound Name | N-(cyclopropylmethyl)-3-fluoro-4-methoxy-N-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65387046 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-(cyclopropylmethyl)-3-fluoro-4-methoxy-N-methyl-5-sulfamoylbenzamide |
| SMILES | COc1c(F)cc(C(=O)N(C)CC2CC2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C13H17FN2O4S/c1-16(7-8-3-4-8)13(17)9-5-10(14)12(20-2)11(6-9)21(15,18)19/h5-6,8H,3-4,7H2,1-2H3,(H2,15,18,19) |
| InChIKey | JKDRDJACAHPSQW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |