C16H16BrNO2 — CID 42987430
N-[(4-bromophenyl)methyl]-2-hydroxy-N,5-dimethylbenzamide (PubChem CID 42987430) has the molecular formula C16H16BrNO2 and a molecular weight of 334.21 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-2-hydroxy-N,5-dimethylbenzamide.
| Compound Name | N-[(4-bromophenyl)methyl]-2-hydroxy-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 42987430 |
| Molecular Formula | C16H16BrNO2 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-2-hydroxy-N,5-dimethylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)N(C)Cc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C16H16BrNO2/c1-11-3-8-15(19)14(9-11)16(20)18(2)10-12-4-6-13(17)7-5-12/h3-9,19H,10H2,1-2H3 |
| InChIKey | INUNTXLKKULSIK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |