C20H25NO2 — CID 31236411
N-[(4-tert-butylphenyl)methyl]-2-hydroxy-N,4-dimethylbenzamide (PubChem CID 31236411) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2-hydroxy-N,4-dimethylbenzamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2-hydroxy-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 31236411 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2-hydroxy-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)Cc2ccc(C(C)(C)C)cc2)c(O)c1 |
| InChI | InChI=1S/C20H25NO2/c1-14-6-11-17(18(22)12-14)19(23)21(5)13-15-7-9-16(10-8-15)20(2,3)4/h6-12,22H,13H2,1-5H3 |
| InChIKey | IKRBQXSRRMRKPU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |