C20H26N2O3S — CID 24546841
N-[(4-tert-butylphenyl)methyl]-N,2-dimethyl-5-sulfamoylbenzamide (PubChem CID 24546841) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-N,2-dimethyl-5-sulfamoylbenzamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-N,2-dimethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 24546841 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-N,2-dimethyl-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)N(C)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O3S/c1-14-6-11-17(26(21,24)25)12-18(14)19(23)22(5)13-15-7-9-16(10-8-15)20(2,3)4/h6-12H,13H2,1-5H3,(H2,21,24,25) |
| InChIKey | FAEKMECCRUYFGE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |