C17H19BrN2O3S — CID 34889810
2-bromo-N-[(4-ethylphenyl)methyl]-N-methyl-5-sulfamoylbenzamide (PubChem CID 34889810) has the molecular formula C17H19BrN2O3S and a molecular weight of 411.32 g/mol. Its IUPAC name is 2-bromo-N-[(4-ethylphenyl)methyl]-N-methyl-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-[(4-ethylphenyl)methyl]-N-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 34889810 |
| Molecular Formula | C17H19BrN2O3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-bromo-N-[(4-ethylphenyl)methyl]-N-methyl-5-sulfamoylbenzamide |
| SMILES | CCc1ccc(CN(C)C(=O)c2cc(S(N)(=O)=O)ccc2Br)cc1 |
| InChI | InChI=1S/C17H19BrN2O3S/c1-3-12-4-6-13(7-5-12)11-20(2)17(21)15-10-14(24(19,22)23)8-9-16(15)18/h4-10H,3,11H2,1-2H3,(H2,19,22,23) |
| InChIKey | VMCRARXGIQJQDB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |