C11H15BrN2O3S — CID 47101234
2-bromo-N,N-diethyl-5-sulfamoylbenzamide (PubChem CID 47101234) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-bromo-N,N-diethyl-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N,N-diethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 47101234 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 2-bromo-N,N-diethyl-5-sulfamoylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(S(N)(=O)=O)ccc1Br |
| InChI | InChI=1S/C11H15BrN2O3S/c1-3-14(4-2)11(15)9-7-8(18(13,16)17)5-6-10(9)12/h5-7H,3-4H2,1-2H3,(H2,13,16,17) |
| InChIKey | XUCHCJNOPBLQGT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |