C16H15Br2FN2O3S — CID 55586408
2-bromo-N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-5-sulfamoylbenzamide (PubChem CID 55586408) has the molecular formula C16H15Br2FN2O3S and a molecular weight of 494.18 g/mol. Its IUPAC name is 2-bromo-N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 55586408 |
| Molecular Formula | C16H15Br2FN2O3S |
| Molecular Weight | 494.18 g/mol |
| Exact Mass | 491.92 |
| IUPAC Name | 2-bromo-N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-5-sulfamoylbenzamide |
| SMILES | CCN(Cc1cc(Br)ccc1F)C(=O)c1cc(S(N)(=O)=O)ccc1Br |
| InChI | InChI=1S/C16H15Br2FN2O3S/c1-2-21(9-10-7-11(17)3-6-15(10)19)16(22)13-8-12(25(20,23)24)4-5-14(13)18/h3-8H,2,9H2,1H3,(H2,20,23,24) |
| InChIKey | LKSGGUUHHCBNQD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.18 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |