C18H18BrFN2O5 — CID 55587782
N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 55587782) has the molecular formula C18H18BrFN2O5 and a molecular weight of 441.25 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 55587782 |
| Molecular Formula | C18H18BrFN2O5 |
| Molecular Weight | 441.25 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-N-ethyl-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | CCN(Cc1cc(Br)ccc1F)C(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18BrFN2O5/c1-4-21(10-11-7-12(19)5-6-14(11)20)18(23)13-8-16(26-2)17(27-3)9-15(13)22(24)25/h5-9H,4,10H2,1-3H3 |
| InChIKey | AJKWHQJOZCDQJV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|