C16H22N2O6 — CID 94799727
N-ethyl-4,5-dimethoxy-2-nitro-N-[[(3R)-oxolan-3-yl]methyl]benzamide (PubChem CID 94799727) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-ethyl-4,5-dimethoxy-2-nitro-N-[[(3R)-oxolan-3-yl]methyl]benzamide.
| Compound Name | N-ethyl-4,5-dimethoxy-2-nitro-N-[[(3R)-oxolan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 94799727 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-ethyl-4,5-dimethoxy-2-nitro-N-[[(3R)-oxolan-3-yl]methyl]benzamide |
| SMILES | CCN(C[C@H]1CCOC1)C(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N2O6/c1-4-17(9-11-5-6-24-10-11)16(19)12-7-14(22-2)15(23-3)8-13(12)18(20)21/h7-8,11H,4-6,9-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | GUYVVWCVWRHICU-LLVKDONJSA-N |
| XLogP | 2.11 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|