C17H23ClN2O5 — CID 52511585
4-(2-amino-2-oxoethoxy)-3-chloro-N-ethyl-5-methoxy-N-[[(3S)-oxolan-3-yl]methyl]benzamide (PubChem CID 52511585) has the molecular formula C17H23ClN2O5 and a molecular weight of 370.83 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-3-chloro-N-ethyl-5-methoxy-N-[[(3S)-oxolan-3-yl]methyl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-ethyl-5-methoxy-N-[[(3S)-oxolan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 52511585 |
| Molecular Formula | C17H23ClN2O5 |
| Molecular Weight | 370.83 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-3-chloro-N-ethyl-5-methoxy-N-[[(3S)-oxolan-3-yl]methyl]benzamide |
| SMILES | CCN(C[C@@H]1CCOC1)C(=O)c1cc(Cl)c(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C17H23ClN2O5/c1-3-20(8-11-4-5-24-9-11)17(22)12-6-13(18)16(14(7-12)23-2)25-10-15(19)21/h6-7,11H,3-5,8-10H2,1-2H3,(H2,19,21)/t11-/m0/s1 |
| InChIKey | JWIOKEVVWJHTAA-NSHDSACASA-N |
| XLogP | 1.71 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.83 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |