C14H15BrN2O3S2 — CID 33031977
2-bromo-N-ethyl-5-sulfamoyl-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 33031977) has the molecular formula C14H15BrN2O3S2 and a molecular weight of 403.32 g/mol. Its IUPAC name is 2-bromo-N-ethyl-5-sulfamoyl-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 2-bromo-N-ethyl-5-sulfamoyl-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 33031977 |
| Molecular Formula | C14H15BrN2O3S2 |
| Molecular Weight | 403.32 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 2-bromo-N-ethyl-5-sulfamoyl-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CCN(Cc1cccs1)C(=O)c1cc(S(N)(=O)=O)ccc1Br |
| InChI | InChI=1S/C14H15BrN2O3S2/c1-2-17(9-10-4-3-7-21-10)14(18)12-8-11(22(16,19)20)5-6-13(12)15/h3-8H,2,9H2,1H3,(H2,16,19,20) |
| InChIKey | HYLKPDKEPKYVHL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.32 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |