C14H15NO3S — CID 103602482
N-ethyl-2,4-dihydroxy-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 103602482) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is N-ethyl-2,4-dihydroxy-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-ethyl-2,4-dihydroxy-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 103602482 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | N-ethyl-2,4-dihydroxy-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | CCN(Cc1cccs1)C(=O)c1ccc(O)cc1O |
| InChI | InChI=1S/C14H15NO3S/c1-2-15(9-11-4-3-7-19-11)14(18)12-6-5-10(16)8-13(12)17/h3-8,16-17H,2,9H2,1H3 |
| InChIKey | QYEGDAABHSUOHD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |