C15H14BrN3O6S2 — CID 27271058
[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2-bromo-5-sulfamoylbenzoate (PubChem CID 27271058) has the molecular formula C15H14BrN3O6S2 and a molecular weight of 476.33 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2-bromo-5-sulfamoylbenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2-bromo-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 27271058 |
| Molecular Formula | C15H14BrN3O6S2 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 474.95 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2-bromo-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(Br)c(C(=O)OCC(=O)NC(=O)NCc2cccs2)c1 |
| InChI | InChI=1S/C15H14BrN3O6S2/c16-12-4-3-10(27(17,23)24)6-11(12)14(21)25-8-13(20)19-15(22)18-7-9-2-1-5-26-9/h1-6H,7-8H2,(H2,17,23,24)(H2,18,19,20,22) |
| InChIKey | ZWBNCXSIDAPRRX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |